C26H24 — CID 145356580
2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-5,7-diphenylcyclohepta-1,3,5-triene (PubChem CID 145356580) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-5,7-diphenylcyclohepta-1,3,5-triene.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-5,7-diphenylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 145356580 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-5,7-diphenylcyclohepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)C1=CC(C)(c2ccccc2)C=C(c2ccccc2)C=C1 |
| InChI | InChI=1S/C26H24/c1-4-12-21(5-2)23-17-18-24(22-13-8-6-9-14-22)20-26(3,19-23)25-15-10-7-11-16-25/h4-20H,1-2H2,3H3/b21-12+ |
| InChIKey | PSXWXWSOIDVJCC-CIAFOILYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|