C21H20 — CID 145358006
(4E,7Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1-phenylcycloocta-1,2,4,7-tetraene (PubChem CID 145358006) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is (4E,7Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1-phenylcycloocta-1,2,4,7-tetraene.
| Compound Name | (4E,7Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1-phenylcycloocta-1,2,4,7-tetraene |
|---|---|
| PubChem CID | 145358006 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (4E,7Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1-phenylcycloocta-1,2,4,7-tetraene |
| SMILES | C=C/C=C(C=C)/C1=C/C/C(C)=C\C(c2ccccc2)=C=C1 |
| InChI | InChI=1S/C21H20/c1-4-9-18(5-2)20-13-12-17(3)16-21(15-14-20)19-10-7-6-8-11-19/h4-11,13-14,16H,1-2,12H2,3H3/b17-16-,18-9+,20-13+ |
| InChIKey | YUWWBCQCDYWJRH-UTXCDMQGSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|