C55H42O3 — CID 178165740
2-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxy-5-phenylphenyl]-(2-hydroxy-3,5-diphenylphenyl)methyl]-4,6-diphenylphenol (PubChem CID 178165740) has the molecular formula C55H42O3 and a molecular weight of 750.94 g/mol. Its IUPAC name is 2-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxy-5-phenylphenyl]-(2-hydroxy-3,5-diphenylphenyl)methyl]-4,6-diphenylphenol.
| Compound Name | 2-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxy-5-phenylphenyl]-(2-hydroxy-3,5-diphenylphenyl)methyl]-4,6-diphenylphenol |
|---|---|
| PubChem CID | 178165740 |
| Molecular Formula | C55H42O3 |
| Molecular Weight | 750.94 g/mol |
| Exact Mass | 750.31 |
| IUPAC Name | 2-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxy-5-phenylphenyl]-(2-hydroxy-3,5-diphenylphenyl)methyl]-4,6-diphenylphenol |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)cc(C(c2cc(-c3ccccc3)cc(-c3ccccc3)c2O)c2cc(-c3ccccc3)cc(-c3ccccc3)c2O)c1O |
| InChI | InChI=1S/C55H42O3/c1-3-20-37(4-2)46-31-43(38-21-10-5-11-22-38)34-49(53(46)56)52(50-35-44(39-23-12-6-13-24-39)32-47(54(50)57)41-27-16-8-17-28-41)51-36-45(40-25-14-7-15-26-40)33-48(55(51)58)42-29-18-9-19-30-42/h3-36,52,56-58H,1-2H2/b37-20+ |
| InChIKey | XFYNPCZDLLYLDL-HASSKWOGSA-N |
| XLogP | 14.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.94 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|