C34H40 — CID 145163330
1-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-diphenyl-5-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 145163330) has the molecular formula C34H40 and a molecular weight of 448.69 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-diphenyl-5-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-diphenyl-5-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 145163330 |
| Molecular Formula | C34H40 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-diphenyl-5-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | C=C/C=C(\C=C)c1cc(C(CC(C)(C)C)C(C)(C)C)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C34H40/c1-9-17-25(10-2)29-22-28(31(34(6,7)8)24-33(3,4)5)23-30(26-18-13-11-14-19-26)32(29)27-20-15-12-16-21-27/h9-23,31H,1-2,24H2,3-8H3/b25-17+ |
| InChIKey | AEOVRCSZIILDSS-KOEQRZSOSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|