C47H46 — CID 145163313
9,9-bis(4-phenylphenyl)-3-(2,2,5,5-tetramethylhexan-3-yl)fluorene (PubChem CID 145163313) has the molecular formula C47H46 and a molecular weight of 610.89 g/mol. Its IUPAC name is 9,9-bis(4-phenylphenyl)-3-(2,2,5,5-tetramethylhexan-3-yl)fluorene.
| Compound Name | 9,9-bis(4-phenylphenyl)-3-(2,2,5,5-tetramethylhexan-3-yl)fluorene |
|---|---|
| PubChem CID | 145163313 |
| Molecular Formula | C47H46 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | 9,9-bis(4-phenylphenyl)-3-(2,2,5,5-tetramethylhexan-3-yl)fluorene |
| SMILES | CC(C)(C)CC(c1ccc2c(c1)-c1ccccc1C2(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C47H46/c1-45(2,3)32-44(46(4,5)6)37-25-30-43-41(31-37)40-19-13-14-20-42(40)47(43,38-26-21-35(22-27-38)33-15-9-7-10-16-33)39-28-23-36(24-29-39)34-17-11-8-12-18-34/h7-31,44H,32H2,1-6H3 |
| InChIKey | VXGNULSEGFUKRS-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |