C17H28O — CID 126723379
[3-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methanol (PubChem CID 126723379) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is [3-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methanol.
| Compound Name | [3-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 126723379 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | [3-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methanol |
| SMILES | CC(C)(C)CC(c1cccc(CO)c1)C(C)(C)C |
| InChI | InChI=1S/C17H28O/c1-16(2,3)11-15(17(4,5)6)14-9-7-8-13(10-14)12-18/h7-10,15,18H,11-12H2,1-6H3 |
| InChIKey | JTTQFXYYGCKHKW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |