C28H28 — CID 145331624
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-7-(4-phenylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene (PubChem CID 145331624) has the molecular formula C28H28 and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-7-(4-phenylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-7-(4-phenylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 145331624 |
| Molecular Formula | C28H28 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-methyl-7-(4-phenylcyclohepta-2,4,6-trien-1-yl)cyclohepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/C)C1=CC=CC(C)(C2C=CC=C(c3ccccc3)C=C2)C=C1 |
| InChI | InChI=1S/C28H28/c1-4-6-12-23(5-2)26-16-11-21-28(3,22-20-26)27-17-10-15-25(18-19-27)24-13-8-7-9-14-24/h4-22,27H,2H2,1,3H3/b6-4-,23-12+ |
| InChIKey | KKRAITQIODUKLY-UTKXYVJPSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|