C21H26S — CID 123298765
hepta-1,3,5-trien-3-yl-methyl-(1-methylcyclohexa-2,4-dien-1-yl)-phenyl-λ4-sulfane (PubChem CID 123298765) has the molecular formula C21H26S and a molecular weight of 310.51 g/mol. Its IUPAC name is hepta-1,3,5-trien-3-yl-methyl-(1-methylcyclohexa-2,4-dien-1-yl)-phenyl-λ4-sulfane.
| Compound Name | hepta-1,3,5-trien-3-yl-methyl-(1-methylcyclohexa-2,4-dien-1-yl)-phenyl-λ4-sulfane |
|---|---|
| PubChem CID | 123298765 |
| Molecular Formula | C21H26S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | hepta-1,3,5-trien-3-yl-methyl-(1-methylcyclohexa-2,4-dien-1-yl)-phenyl-λ4-sulfane |
| SMILES | C=CC(=CC=CC)S(C)(c1ccccc1)C1(C)C=CC=CC1 |
| InChI | InChI=1S/C21H26S/c1-5-7-14-19(6-2)22(4,20-15-10-8-11-16-20)21(3)17-12-9-13-18-21/h5-17H,2,18H2,1,3-4H3 |
| InChIKey | KIOLUWHHIDRTCI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|