C60H56N2 — CID 139493370
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(1-methylcyclohexa-2,4-dien-1-yl)-1-N,6-N-diphenyl-1-N,6-N-bis(4-propan-2-ylphenyl)pyrene-1,6-diamine (PubChem CID 139493370) has the molecular formula C60H56N2 and a molecular weight of 805.12 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(1-methylcyclohexa-2,4-dien-1-yl)-1-N,6-N-diphenyl-1-N,6-N-bis(4-propan-2-ylphenyl)pyrene-1,6-diamine.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(1-methylcyclohexa-2,4-dien-1-yl)-1-N,6-N-diphenyl-1-N,6-N-bis(4-propan-2-ylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 139493370 |
| Molecular Formula | C60H56N2 |
| Molecular Weight | 805.12 g/mol |
| Exact Mass | 804.44 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(1-methylcyclohexa-2,4-dien-1-yl)-1-N,6-N-diphenyl-1-N,6-N-bis(4-propan-2-ylphenyl)pyrene-1,6-diamine |
| SMILES | C=C/C(=C\C=C/C)c1cc(N(c2ccccc2)c2ccc(C(C)C)cc2)c2ccc3c(C4(C)C=CC=CC4)cc(N(c4ccccc4)c4ccc(C(C)C)cc4)c4ccc1c2c43 |
| InChI | InChI=1S/C60H56N2/c1-8-10-20-43(9-2)54-39-56(61(46-21-14-11-15-22-46)48-29-25-44(26-30-48)41(3)4)52-36-34-51-55(60(7)37-18-13-19-38-60)40-57(53-35-33-50(54)58(52)59(51)53)62(47-23-16-12-17-24-47)49-31-27-45(28-32-49)42(5)6/h8-37,39-42H,2,38H2,1,3-7H3/b10-8-,43-20+ |
| InChIKey | MOCSTOCZPJIGEX-RDSDEJNUSA-N |
| XLogP | 17.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.12 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|