C14H18N+ — CID 123513372
2-hexa-1,3,5-trien-3-yl-1-propan-2-ylpyridin-1-ium (PubChem CID 123513372) has the molecular formula C14H18N+ and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-hexa-1,3,5-trien-3-yl-1-propan-2-ylpyridin-1-ium.
| Compound Name | 2-hexa-1,3,5-trien-3-yl-1-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 123513372 |
| Molecular Formula | C14H18N+ |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-hexa-1,3,5-trien-3-yl-1-propan-2-ylpyridin-1-ium |
| SMILES | C=CC=C(C=C)c1cccc[n+]1C(C)C |
| InChI | InChI=1S/C14H18N/c1-5-9-13(6-2)14-10-7-8-11-15(14)12(3)4/h5-12H,1-2H2,3-4H3/q+1 |
| InChIKey | OWMRPWUFDGTEOG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|