C21H16O2 — CID 70960677
9a-methyl-3-phenyl-4aH-anthracene-9,10-dione (PubChem CID 70960677) has the molecular formula C21H16O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 9a-methyl-3-phenyl-4aH-anthracene-9,10-dione.
| Compound Name | 9a-methyl-3-phenyl-4aH-anthracene-9,10-dione |
|---|---|
| PubChem CID | 70960677 |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 9a-methyl-3-phenyl-4aH-anthracene-9,10-dione |
| SMILES | CC12C=CC(c3ccccc3)=CC1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16O2/c1-21-12-11-15(14-7-3-2-4-8-14)13-18(21)19(22)16-9-5-6-10-17(16)20(21)23/h2-13,18H,1H3 |
| InChIKey | BITYIIQEXVUHPB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|