C13H13BrO2 — CID 142666137
6-bromo-1-methoxy-4-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 142666137) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 6-bromo-1-methoxy-4-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-bromo-1-methoxy-4-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 142666137 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 6-bromo-1-methoxy-4-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | COC1(O)C=CC(c2ccccc2)=CC1Br |
| InChI | InChI=1S/C13H13BrO2/c1-16-13(15)8-7-11(9-12(13)14)10-5-3-2-4-6-10/h2-9,12,15H,1H3 |
| InChIKey | TWIPOSATOSAPIQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|