C36H30O4 — CID 70399651
4-(4-hydroxyphenyl)phenol;6-phenyl-4-(3-phenylphenyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 70399651) has the molecular formula C36H30O4 and a molecular weight of 526.63 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)phenol;6-phenyl-4-(3-phenylphenyl)cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-(4-hydroxyphenyl)phenol;6-phenyl-4-(3-phenylphenyl)cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 70399651 |
| Molecular Formula | C36H30O4 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 4-(4-hydroxyphenyl)phenol;6-phenyl-4-(3-phenylphenyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC(c2cccc(-c3ccccc3)c2)=CC1c1ccccc1.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H20O2.C12H10O2/c25-24(26)15-14-22(17-23(24)19-10-5-2-6-11-19)21-13-7-12-20(16-21)18-8-3-1-4-9-18;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-17,23,25-26H;1-8,13-14H |
| InChIKey | MZVXIXSAMDWPAY-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|