C12H14O6 — CID 45116850
5-phenylcyclohex-5-ene-1,1,2,2,4,4-hexol (PubChem CID 45116850) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-phenylcyclohex-5-ene-1,1,2,2,4,4-hexol.
| Compound Name | 5-phenylcyclohex-5-ene-1,1,2,2,4,4-hexol |
|---|---|
| PubChem CID | 45116850 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-phenylcyclohex-5-ene-1,1,2,2,4,4-hexol |
| SMILES | OC1(O)CC(O)(O)C(O)(O)C=C1c1ccccc1 |
| InChI | InChI=1S/C12H14O6/c13-10(14)7-12(17,18)11(15,16)6-9(10)8-4-2-1-3-5-8/h1-6,13-18H,7H2 |
| InChIKey | BQDFKGKKIRBGPX-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|