C18H16O6 — CID 139936621
3,3-bis(2-hydroxyphenyl)cyclobutane-1,1-dicarboxylic acid (PubChem CID 139936621) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3,3-bis(2-hydroxyphenyl)cyclobutane-1,1-dicarboxylic acid.
| Compound Name | 3,3-bis(2-hydroxyphenyl)cyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 139936621 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3,3-bis(2-hydroxyphenyl)cyclobutane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CC(c2ccccc2O)(c2ccccc2O)C1 |
| InChI | InChI=1S/C18H16O6/c19-13-7-3-1-5-11(13)17(12-6-2-4-8-14(12)20)9-18(10-17,15(21)22)16(23)24/h1-8,19-20H,9-10H2,(H,21,22)(H,23,24) |
| InChIKey | RHUPSIUGBNFILX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|