C25H22N4 — CID 142714030
9,9'-spirobi[fluorene]-2',2',7',7'-tetramine (PubChem CID 142714030) has the molecular formula C25H22N4 and a molecular weight of 378.48 g/mol. Its IUPAC name is 9,9'-spirobi[fluorene]-2',2',7',7'-tetramine.
| Compound Name | 9,9'-spirobi[fluorene]-2',2',7',7'-tetramine |
|---|---|
| PubChem CID | 142714030 |
| Molecular Formula | C25H22N4 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 9,9'-spirobi[fluorene]-2',2',7',7'-tetramine |
| SMILES | NC1(N)C=CC2=C3C=CC(N)(N)C=C3C3(C2=C1)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C25H22N4/c26-23(27)11-9-17-18-10-12-24(28,29)14-22(18)25(21(17)13-23)19-7-3-1-5-15(19)16-6-2-4-8-20(16)25/h1-14H,26-29H2 |
| InChIKey | KYJOJPYHEWFZQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|