C33H34 — CID 163286896
2,2-ditert-butylspiro[1H-fluorene-9,9'-fluorene] (PubChem CID 163286896) has the molecular formula C33H34 and a molecular weight of 430.64 g/mol. Its IUPAC name is 2,2-ditert-butylspiro[1H-fluorene-9,9'-fluorene].
| Compound Name | 2,2-ditert-butylspiro[1H-fluorene-9,9'-fluorene] |
|---|---|
| PubChem CID | 163286896 |
| Molecular Formula | C33H34 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2,2-ditert-butylspiro[1H-fluorene-9,9'-fluorene] |
| SMILES | CC(C)(C)C1(C(C)(C)C)C=CC2=C(C1)C1(c3ccccc32)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H34/c1-30(2,3)32(31(4,5)6)20-19-25-24-15-9-12-18-28(24)33(29(25)21-32)26-16-10-7-13-22(26)23-14-8-11-17-27(23)33/h7-20H,21H2,1-6H3 |
| InChIKey | WFNGHPOAXPKCPI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |