C28H28 — CID 144703387
1,4-bis(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)naphthalene (PubChem CID 144703387) has the molecular formula C28H28 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1,4-bis(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)naphthalene.
| Compound Name | 1,4-bis(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)naphthalene |
|---|---|
| PubChem CID | 144703387 |
| Molecular Formula | C28H28 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1,4-bis(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)naphthalene |
| SMILES | CC1(C)C=CC=C(c2ccc(C3=CC=CC(C)(C)C=C3)c3ccccc23)C=C1 |
| InChI | InChI=1S/C28H28/c1-27(2)17-7-9-21(15-19-27)23-13-14-24(26-12-6-5-11-25(23)26)22-10-8-18-28(3,4)20-16-22/h5-20H,1-4H3 |
| InChIKey | RQTHDVKBXXRFKS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |