C14H15I — CID 163543681
3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-1λ3-iodacyclohexa-1,3,5-triene (PubChem CID 163543681) has the molecular formula C14H15I and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-1λ3-iodacyclohexa-1,3,5-triene.
| Compound Name | 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-1λ3-iodacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 163543681 |
| Molecular Formula | C14H15I |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-1λ3-iodacyclohexa-1,3,5-triene |
| SMILES | CC1(C)C=CC=C(C2=CC=CI=C2)C=C1 |
| InChI | InChI=1S/C14H15I/c1-14(2)8-3-5-12(7-9-14)13-6-4-10-15-11-13/h3-11H,1-2H3 |
| InChIKey | FDEZKVBNECTSSZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|