C29H28 — CID 144703404
9-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)phenyl]-4,12-dimethyltricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene (PubChem CID 144703404) has the molecular formula C29H28 and a molecular weight of 376.54 g/mol. Its IUPAC name is 9-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)phenyl]-4,12-dimethyltricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene.
| Compound Name | 9-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)phenyl]-4,12-dimethyltricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene |
|---|---|
| PubChem CID | 144703404 |
| Molecular Formula | C29H28 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 9-[4-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)phenyl]-4,12-dimethyltricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene |
| SMILES | CC1(C)C=CC=C(c2ccc(C3=CC=C4C=CC5(C)C=CC(=C3)C45C)cc2)C=C1 |
| InChI | InChI=1S/C29H28/c1-27(2)16-5-6-21(13-17-27)22-7-9-23(10-8-22)24-11-12-25-14-18-28(3)19-15-26(20-24)29(25,28)4/h5-20H,1-4H3 |
| InChIKey | JWZOVPPIHQDSJP-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |