C11H22 — CID 91022603
5,5-dimethylcyclopenta-1,3-diene;ethane (PubChem CID 91022603) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 5,5-dimethylcyclopenta-1,3-diene;ethane.
| Compound Name | 5,5-dimethylcyclopenta-1,3-diene;ethane |
|---|---|
| PubChem CID | 91022603 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 5,5-dimethylcyclopenta-1,3-diene;ethane |
| SMILES | CC.CC.CC1(C)C=CC=C1 |
| InChI | InChI=1S/C7H10.2C2H6/c1-7(2)5-3-4-6-7;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | JKYKCHICGJEZFP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |