C26H20 — CID 90786287
1,4-di(cyclooctatetraenyl)naphthalene (PubChem CID 90786287) has the molecular formula C26H20 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1,4-di(cyclooctatetraenyl)naphthalene.
| Compound Name | 1,4-di(cyclooctatetraenyl)naphthalene |
|---|---|
| PubChem CID | 90786287 |
| Molecular Formula | C26H20 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1,4-di(cyclooctatetraenyl)naphthalene |
| SMILES | C1=CC=CC(c2ccc(C3=CC=CC=CC=C3)c3ccccc23)=CC=C1 |
| InChI | InChI=1S/C26H20/c1-3-7-13-21(14-8-4-1)23-19-20-24(26-18-12-11-17-25(23)26)22-15-9-5-2-6-10-16-22/h1-20H |
| InChIKey | RKEFBVRMPLROEW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |