C36H35BO — CID 174304874
2-[3-(cyclododecahexaenyl)-4,5-diphenylphenyl]-3,3,4,4-tetramethyloxaboretane (PubChem CID 174304874) has the molecular formula C36H35BO and a molecular weight of 494.49 g/mol. Its IUPAC name is 2-[3-(cyclododecahexaenyl)-4,5-diphenylphenyl]-3,3,4,4-tetramethyloxaboretane.
| Compound Name | 2-[3-(cyclododecahexaenyl)-4,5-diphenylphenyl]-3,3,4,4-tetramethyloxaboretane |
|---|---|
| PubChem CID | 174304874 |
| Molecular Formula | C36H35BO |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 2-[3-(cyclododecahexaenyl)-4,5-diphenylphenyl]-3,3,4,4-tetramethyloxaboretane |
| SMILES | CC1(C)OB(c2cc(C3=C/C=C\C=C/C=C/C=C/C=C3)c(-c3ccccc3)c(-c3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C36H35BO/c1-35(2)36(3,4)38-37(35)31-26-32(28-20-14-10-8-6-5-7-9-11-15-21-28)34(30-24-18-13-19-25-30)33(27-31)29-22-16-12-17-23-29/h5-27H,1-4H3/b6-5+,7-5+,8-6-,9-7-,10-8-,11-9+,14-10-,15-11?,20-14?,21-15?,28-20?,28-21? |
| InChIKey | VTIWMUXZJWRQIK-YUMRLWSZSA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|