About 2-naphthalen-1-yl-1H-azepine;pentalene
2-naphthalen-1-yl-1H-azepine;pentalene (PubChem CID 162226529) has the molecular formula C24H19N
and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-naphthalen-1-yl-1H-azepine;pentalene.
Molecular Properties
| Compound Name | 2-naphthalen-1-yl-1H-azepine;pentalene |
| PubChem CID | 162226529 |
| Molecular Formula | C24H19N |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-naphthalen-1-yl-1H-azepine;pentalene |
| SMILES | C1=CC2=CC=CC2=C1.C1=CC=C(c2cccc3ccccc23)NC=C1 |
| InChI | InChI=1S/C16H13N.C8H6/c1-2-11-16(17-12-5-1)15-10-6-8-13-7-3-4-9-14(13)15;1-3-7-5-2-6-8(7)4-1/h1-12,17H;1-6H |
| InChIKey | ZUVMVTBOLDUOIP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-naphthalen-1-yl-1H-azepine;pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-yl-1H-azepine;pentalene?
The IUPAC name of 2-naphthalen-1-yl-1H-azepine;pentalene (CID 162226529) is 2-naphthalen-1-yl-1H-azepine;pentalene.
What is the SMILES notation for 2-naphthalen-1-yl-1H-azepine;pentalene?
The canonical SMILES for 2-naphthalen-1-yl-1H-azepine;pentalene is C1=CC2=CC=CC2=C1.C1=CC=C(c2cccc3ccccc23)NC=C1.
What is the InChIKey of 2-naphthalen-1-yl-1H-azepine;pentalene?
The InChIKey is ZUVMVTBOLDUOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N.C8H6/c1-2-11-16(17-12-5-1)15-10-6-8-13-7-3-4-9-14(13)15;1-3-7-5-2-6-8(7)4-1/h1-12,17H;1-6H.
What are the key properties of 2-naphthalen-1-yl-1H-azepine;pentalene?
2-naphthalen-1-yl-1H-azepine;pentalene has a molecular weight of 321.42 g/mol, XLogP of 5.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yl-1H-azepine;pentalene is sourced from PubChem (CID 162226529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).