About bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene
bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 123639950) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene.
Analyze bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene?
The IUPAC name of bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene (CID 123639950) is bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene.
What is the SMILES notation for bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene?
The canonical SMILES for bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene is C1=CC=CC=C2C=C2C=CC=C1.
What is the InChIKey of bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene?
The InChIKey is BLCACQGJIUMEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-2-4-6-8-11-10-12(11)9-7-5-3-1/h1-10H.
What are the key properties of bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene?
bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene has a molecular weight of 154.21 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[9.1.0]dodeca-1(12),2,4,6,8,10-hexaene is sourced from PubChem (CID 123639950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).