About 1H-cyclohepta[b]pyridine;hydrofluoride
1H-cyclohepta[b]pyridine;hydrofluoride (PubChem CID 161223924) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 1H-cyclohepta[b]pyridine;hydrofluoride.
Molecular Properties
| Compound Name | 1H-cyclohepta[b]pyridine;hydrofluoride |
| PubChem CID | 161223924 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1H-cyclohepta[b]pyridine;hydrofluoride |
| SMILES | C1=CC=C2NC=CC=C2C=C1.F |
| InChI | InChI=1S/C10H9N.FH/c1-2-5-9-6-4-8-11-10(9)7-3-1;/h1-8,11H;1H |
| InChIKey | UXWKWZZPGGHFPF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-cyclohepta[b]pyridine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclohepta[b]pyridine;hydrofluoride?
The IUPAC name of 1H-cyclohepta[b]pyridine;hydrofluoride (CID 161223924) is 1H-cyclohepta[b]pyridine;hydrofluoride.
What is the SMILES notation for 1H-cyclohepta[b]pyridine;hydrofluoride?
The canonical SMILES for 1H-cyclohepta[b]pyridine;hydrofluoride is C1=CC=C2NC=CC=C2C=C1.F.
What is the InChIKey of 1H-cyclohepta[b]pyridine;hydrofluoride?
The InChIKey is UXWKWZZPGGHFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.FH/c1-2-5-9-6-4-8-11-10(9)7-3-1;/h1-8,11H;1H.
What are the key properties of 1H-cyclohepta[b]pyridine;hydrofluoride?
1H-cyclohepta[b]pyridine;hydrofluoride has a molecular weight of 163.19 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclohepta[b]pyridine;hydrofluoride is sourced from PubChem (CID 161223924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).