C9H8N4 — CID 66584433
2-(1,3,5-triazin-2-yl)-1H-azepine (PubChem CID 66584433) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(1,3,5-triazin-2-yl)-1H-azepine.
| Compound Name | 2-(1,3,5-triazin-2-yl)-1H-azepine |
|---|---|
| PubChem CID | 66584433 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(1,3,5-triazin-2-yl)-1H-azepine |
| SMILES | C1=CC=C(c2ncncn2)NC=C1 |
| InChI | InChI=1S/C9H8N4/c1-2-4-8(11-5-3-1)9-12-6-10-7-13-9/h1-7,11H |
| InChIKey | BUJIXHISIFAJMC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |