About 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene
2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 151620754) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene.
Analyze 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene?
The IUPAC name of 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene (CID 151620754) is 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene.
What is the SMILES notation for 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene?
The canonical SMILES for 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene is C1=CC=C2N=NC=CC=C2C=C1.
What is the InChIKey of 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene?
The InChIKey is QOLPMKTWRZLVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-5-9-6-4-8-11-12-10(9)7-3-1/h1-8H.
What are the key properties of 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene?
2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene has a molecular weight of 156.19 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diazabicyclo[5.5.0]dodeca-1(12),2,4,6,8,10-hexaene is sourced from PubChem (CID 151620754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).