About cyclohepta[e]thiadiazine;hydrochloride
cyclohepta[e]thiadiazine;hydrochloride (PubChem CID 160560969) has the molecular formula C8H7ClN2S
and a molecular weight of 198.68 g/mol. Its IUPAC name is cyclohepta[e]thiadiazine;hydrochloride.
Molecular Properties
| Compound Name | cyclohepta[e]thiadiazine;hydrochloride |
| PubChem CID | 160560969 |
| Molecular Formula | C8H7ClN2S |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | cyclohepta[e]thiadiazine;hydrochloride |
| SMILES | C1=CC=C2SN=NC=C2C=C1.Cl |
| InChI | InChI=1S/C8H6N2S.ClH/c1-2-4-7-6-9-10-11-8(7)5-3-1;/h1-6H;1H |
| InChIKey | QZHNQUAQIYQAKS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohepta[e]thiadiazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[e]thiadiazine;hydrochloride?
The IUPAC name of cyclohepta[e]thiadiazine;hydrochloride (CID 160560969) is cyclohepta[e]thiadiazine;hydrochloride.
What is the SMILES notation for cyclohepta[e]thiadiazine;hydrochloride?
The canonical SMILES for cyclohepta[e]thiadiazine;hydrochloride is C1=CC=C2SN=NC=C2C=C1.Cl.
What is the InChIKey of cyclohepta[e]thiadiazine;hydrochloride?
The InChIKey is QZHNQUAQIYQAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S.ClH/c1-2-4-7-6-9-10-11-8(7)5-3-1;/h1-6H;1H.
What are the key properties of cyclohepta[e]thiadiazine;hydrochloride?
cyclohepta[e]thiadiazine;hydrochloride has a molecular weight of 198.68 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[e]thiadiazine;hydrochloride is sourced from PubChem (CID 160560969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).