C12H10O — CID 87150947
3-oxatricyclo[6.5.0.02,4]trideca-1(13),5,7,9,11-pentaene (PubChem CID 87150947) has the molecular formula C12H10O and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-oxatricyclo[6.5.0.02,4]trideca-1(13),5,7,9,11-pentaene.
| Compound Name | 3-oxatricyclo[6.5.0.02,4]trideca-1(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 87150947 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-oxatricyclo[6.5.0.02,4]trideca-1(13),5,7,9,11-pentaene |
| SMILES | C1=CC=C2C(=CC=CC3OC23)C=C1 |
| InChI | InChI=1S/C12H10O/c1-2-5-9-6-4-8-11-12(13-11)10(9)7-3-1/h1-8,11-12H |
| InChIKey | DHCHVGRJXUZYQY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|