About cyclopenta[c]pyrazole;hydrochloride
cyclopenta[c]pyrazole;hydrochloride (PubChem CID 141400711) has the molecular formula C6H5ClN2
and a molecular weight of 140.57 g/mol. Its IUPAC name is cyclopenta[c]pyrazole;hydrochloride.
Molecular Properties
| Compound Name | cyclopenta[c]pyrazole;hydrochloride |
| PubChem CID | 141400711 |
| Molecular Formula | C6H5ClN2 |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.01 |
| IUPAC Name | cyclopenta[c]pyrazole;hydrochloride |
| SMILES | C1=CC2=CN=NC2=C1.Cl |
| InChI | InChI=1S/C6H4N2.ClH/c1-2-5-4-7-8-6(5)3-1;/h1-4H;1H |
| InChIKey | SXDPFUVGFQZQFU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[c]pyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[c]pyrazole;hydrochloride?
The IUPAC name of cyclopenta[c]pyrazole;hydrochloride (CID 141400711) is cyclopenta[c]pyrazole;hydrochloride.
What is the SMILES notation for cyclopenta[c]pyrazole;hydrochloride?
The canonical SMILES for cyclopenta[c]pyrazole;hydrochloride is C1=CC2=CN=NC2=C1.Cl.
What is the InChIKey of cyclopenta[c]pyrazole;hydrochloride?
The InChIKey is SXDPFUVGFQZQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2.ClH/c1-2-5-4-7-8-6(5)3-1;/h1-4H;1H.
What are the key properties of cyclopenta[c]pyrazole;hydrochloride?
cyclopenta[c]pyrazole;hydrochloride has a molecular weight of 140.57 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[c]pyrazole;hydrochloride is sourced from PubChem (CID 141400711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).