C12H8N2O — CID 155923318
chromeno[3,2-c]diazepine (PubChem CID 155923318) has the molecular formula C12H8N2O and a molecular weight of 196.21 g/mol. Its IUPAC name is chromeno[3,2-c]diazepine.
| Compound Name | chromeno[3,2-c]diazepine |
|---|---|
| PubChem CID | 155923318 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | chromeno[3,2-c]diazepine |
| SMILES | C1=CN=NC2=Cc3ccccc3OC2=C1 |
| InChI | InChI=1S/C12H8N2O/c1-2-5-11-9(4-1)8-10-12(15-11)6-3-7-13-14-10/h1-8H |
| InChIKey | TWFFITGMWYOJBJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |