About 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride
2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride (PubChem CID 159983148) has the molecular formula C13H9Cl2F3OS
and a molecular weight of 341.18 g/mol. Its IUPAC name is 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride |
| PubChem CID | 159983148 |
| Molecular Formula | C13H9Cl2F3OS |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)C1=CC=C2Oc3ccccc3C=C2S1 |
| InChI | InChI=1S/C13H7F3OS.2ClH/c14-13(15,16)12-6-5-10-11(18-12)7-8-3-1-2-4-9(8)17-10;;/h1-7H;2*1H |
| InChIKey | OGAKVUXPTGGNET-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride?
The IUPAC name of 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride (CID 159983148) is 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride.
What is the SMILES notation for 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride?
The canonical SMILES for 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride is Cl.Cl.FC(F)(F)C1=CC=C2Oc3ccccc3C=C2S1.
What is the InChIKey of 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride?
The InChIKey is OGAKVUXPTGGNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3OS.2ClH/c14-13(15,16)12-6-5-10-11(18-12)7-8-3-1-2-4-9(8)17-10;;/h1-7H;2*1H.
What are the key properties of 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride?
2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride has a molecular weight of 341.18 g/mol, XLogP of 5.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)thiopyrano[3,2-b]chromene;dihydrochloride is sourced from PubChem (CID 159983148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).