C12H10O — CID 86188664
1,2-dihydrocyclopenta[b]chromene (PubChem CID 86188664) has the molecular formula C12H10O and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,2-dihydrocyclopenta[b]chromene.
| Compound Name | 1,2-dihydrocyclopenta[b]chromene |
|---|---|
| PubChem CID | 86188664 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1,2-dihydrocyclopenta[b]chromene |
| SMILES | C1=C2CCC=C2Oc2ccccc21 |
| InChI | InChI=1S/C12H10O/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)13-11/h1-2,4,6-8H,3,5H2 |
| InChIKey | HBLJCWJDBFTLJU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |