C13H12O2 — CID 86188658
6-methoxy-1,2-dihydrocyclopenta[b]chromene (PubChem CID 86188658) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-methoxy-1,2-dihydrocyclopenta[b]chromene.
| Compound Name | 6-methoxy-1,2-dihydrocyclopenta[b]chromene |
|---|---|
| PubChem CID | 86188658 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 6-methoxy-1,2-dihydrocyclopenta[b]chromene |
| SMILES | COc1ccc2c(c1)OC1=CCCC1=C2 |
| InChI | InChI=1S/C13H12O2/c1-14-11-6-5-10-7-9-3-2-4-12(9)15-13(10)8-11/h4-8H,2-3H2,1H3 |
| InChIKey | UWEGQQANIYZBTQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |