C13H16O3 — CID 70516159
3,7-dimethoxy-2,2-dimethylchromene (PubChem CID 70516159) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3,7-dimethoxy-2,2-dimethylchromene.
| Compound Name | 3,7-dimethoxy-2,2-dimethylchromene |
|---|---|
| PubChem CID | 70516159 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3,7-dimethoxy-2,2-dimethylchromene |
| SMILES | COC1=Cc2ccc(OC)cc2OC1(C)C |
| InChI | InChI=1S/C13H16O3/c1-13(2)12(15-4)7-9-5-6-10(14-3)8-11(9)16-13/h5-8H,1-4H3 |
| InChIKey | UJNNPOHYEFGEIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |