C7H6O3S — CID 123805360
5-methoxy-1,3,2-benzodioxathiole (PubChem CID 123805360) has the molecular formula C7H6O3S and a molecular weight of 170.19 g/mol. Its IUPAC name is 5-methoxy-1,3,2-benzodioxathiole.
| Compound Name | 5-methoxy-1,3,2-benzodioxathiole |
|---|---|
| PubChem CID | 123805360 |
| Molecular Formula | C7H6O3S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 5-methoxy-1,3,2-benzodioxathiole |
| SMILES | COc1ccc2c(c1)OSO2 |
| InChI | InChI=1S/C7H6O3S/c1-8-5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3 |
| InChIKey | UWZHRBVRKAXFTC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|