C7H6F3NO — CID 87910530
N,N,2-trifluoro-4-methoxyaniline (PubChem CID 87910530) has the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. Its IUPAC name is N,N,2-trifluoro-4-methoxyaniline.
| Compound Name | N,N,2-trifluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 87910530 |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | N,N,2-trifluoro-4-methoxyaniline |
| SMILES | COc1ccc(N(F)F)c(F)c1 |
| InChI | InChI=1S/C7H6F3NO/c1-12-5-2-3-7(11(9)10)6(8)4-5/h2-4H,1H3 |
| InChIKey | UOYJWTBTSAITCM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|