C9H8O3 — CID 87680387
6-methoxy-1,2-benzodioxine (PubChem CID 87680387) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 6-methoxy-1,2-benzodioxine.
| Compound Name | 6-methoxy-1,2-benzodioxine |
|---|---|
| PubChem CID | 87680387 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 6-methoxy-1,2-benzodioxine |
| SMILES | COc1ccc2c(c1)C=COO2 |
| InChI | InChI=1S/C9H8O3/c1-10-8-2-3-9-7(6-8)4-5-11-12-9/h2-6H,1H3 |
| InChIKey | QQFCUILUEQYCBU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|