C17H13F3O3 — CID 141004210
(2S)-6-(4-methoxyphenoxy)-2-(trifluoromethyl)-2H-chromene (PubChem CID 141004210) has the molecular formula C17H13F3O3 and a molecular weight of 322.28 g/mol. Its IUPAC name is (2S)-6-(4-methoxyphenoxy)-2-(trifluoromethyl)-2H-chromene.
| Compound Name | (2S)-6-(4-methoxyphenoxy)-2-(trifluoromethyl)-2H-chromene |
|---|---|
| PubChem CID | 141004210 |
| Molecular Formula | C17H13F3O3 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2S)-6-(4-methoxyphenoxy)-2-(trifluoromethyl)-2H-chromene |
| SMILES | COc1ccc(Oc2ccc3c(c2)C=C[C@@H](C(F)(F)F)O3)cc1 |
| InChI | InChI=1S/C17H13F3O3/c1-21-12-3-5-13(6-4-12)22-14-7-8-15-11(10-14)2-9-16(23-15)17(18,19)20/h2-10,16H,1H3/t16-/m0/s1 |
| InChIKey | SLRSHKFYGDYVEI-INIZCTEOSA-N |
| XLogP | 4.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |