C20H16ClF3O4 — CID 141097858
methyl 3-[4-[[6-chloro-2-(trifluoromethyl)-2H-chromen-7-yl]oxy]phenyl]propanoate (PubChem CID 141097858) has the molecular formula C20H16ClF3O4 and a molecular weight of 412.79 g/mol. Its IUPAC name is methyl 3-[4-[[6-chloro-2-(trifluoromethyl)-2H-chromen-7-yl]oxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[6-chloro-2-(trifluoromethyl)-2H-chromen-7-yl]oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 141097858 |
| Molecular Formula | C20H16ClF3O4 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | methyl 3-[4-[[6-chloro-2-(trifluoromethyl)-2H-chromen-7-yl]oxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(Oc2cc3c(cc2Cl)C=CC(C(F)(F)F)O3)cc1 |
| InChI | InChI=1S/C20H16ClF3O4/c1-26-19(25)9-4-12-2-6-14(7-3-12)27-17-11-16-13(10-15(17)21)5-8-18(28-16)20(22,23)24/h2-3,5-8,10-11,18H,4,9H2,1H3 |
| InChIKey | PUDMESBSDHKBOT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |