C14H12F6O3 — CID 91394034
2-[6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromen-8-yl]propan-2-ol (PubChem CID 91394034) has the molecular formula C14H12F6O3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 2-[6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromen-8-yl]propan-2-ol.
| Compound Name | 2-[6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromen-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 91394034 |
| Molecular Formula | C14H12F6O3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromen-8-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C=C2 |
| InChI | InChI=1S/C14H12F6O3/c1-12(2,21)9-6-8(23-14(18,19)20)5-7-3-4-10(13(15,16)17)22-11(7)9/h3-6,10,21H,1-2H3 |
| InChIKey | NZMXZAPMHIJDCF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |