C13H10F6O3 — CID 141097929
2-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-8-ol (PubChem CID 141097929) has the molecular formula C13H10F6O3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 2-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-8-ol.
| Compound Name | 2-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-8-ol |
|---|---|
| PubChem CID | 141097929 |
| Molecular Formula | C13H10F6O3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-8-ol |
| SMILES | CCC1(C(F)(F)F)C=Cc2cc(OC(F)(F)F)cc(O)c2O1 |
| InChI | InChI=1S/C13H10F6O3/c1-2-11(12(14,15)16)4-3-7-5-8(21-13(17,18)19)6-9(20)10(7)22-11/h3-6,20H,2H2,1H3 |
| InChIKey | SYSMVFZPRREOKQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |