C17H15F6NO7 — CID 122699825
[8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-2-yl]methyl 3-nitrooxypropanoate (PubChem CID 122699825) has the molecular formula C17H15F6NO7 and a molecular weight of 459.30 g/mol. Its IUPAC name is [8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-2-yl]methyl 3-nitrooxypropanoate.
| Compound Name | [8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-2-yl]methyl 3-nitrooxypropanoate |
|---|---|
| PubChem CID | 122699825 |
| Molecular Formula | C17H15F6NO7 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromen-2-yl]methyl 3-nitrooxypropanoate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(COC(=O)CCO[N+](=O)[O-])(C(F)(F)F)C=C2 |
| InChI | InChI=1S/C17H15F6NO7/c1-2-10-7-12(30-17(21,22)23)8-11-3-5-15(16(18,19)20,31-14(10)11)9-28-13(25)4-6-29-24(26)27/h3,5,7-8H,2,4,6,9H2,1H3 |
| InChIKey | UEBCPDGYYUGQRR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|