C19H20ClF3N2O10 — CID 122700203
[7-tert-butyl-6-chloro-2-(trifluoromethyl)chromen-2-yl]methyl 1,3-dinitrooxypropan-2-yl carbonate (PubChem CID 122700203) has the molecular formula C19H20ClF3N2O10 and a molecular weight of 528.82 g/mol. Its IUPAC name is [7-tert-butyl-6-chloro-2-(trifluoromethyl)chromen-2-yl]methyl 1,3-dinitrooxypropan-2-yl carbonate.
| Compound Name | [7-tert-butyl-6-chloro-2-(trifluoromethyl)chromen-2-yl]methyl 1,3-dinitrooxypropan-2-yl carbonate |
|---|---|
| PubChem CID | 122700203 |
| Molecular Formula | C19H20ClF3N2O10 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | [7-tert-butyl-6-chloro-2-(trifluoromethyl)chromen-2-yl]methyl 1,3-dinitrooxypropan-2-yl carbonate |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=CC(COC(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-])(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H20ClF3N2O10/c1-17(2,3)13-7-15-11(6-14(13)20)4-5-18(35-15,19(21,22)23)10-31-16(26)34-12(8-32-24(27)28)9-33-25(29)30/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | MVMNYBHYSNEBDH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 149.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|