C17H16Cl2F3NO8 — CID 122700425
1-[(2S)-6,8-dichloro-2-(trifluoromethyl)chromen-2-yl]ethyl 2-(2-nitrooxyethoxy)ethyl carbonate (PubChem CID 122700425) has the molecular formula C17H16Cl2F3NO8 and a molecular weight of 490.21 g/mol. Its IUPAC name is 1-[(2S)-6,8-dichloro-2-(trifluoromethyl)chromen-2-yl]ethyl 2-(2-nitrooxyethoxy)ethyl carbonate.
| Compound Name | 1-[(2S)-6,8-dichloro-2-(trifluoromethyl)chromen-2-yl]ethyl 2-(2-nitrooxyethoxy)ethyl carbonate |
|---|---|
| PubChem CID | 122700425 |
| Molecular Formula | C17H16Cl2F3NO8 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 1-[(2S)-6,8-dichloro-2-(trifluoromethyl)chromen-2-yl]ethyl 2-(2-nitrooxyethoxy)ethyl carbonate |
| SMILES | CC(OC(=O)OCCOCCO[N+](=O)[O-])[C@]1(C(F)(F)F)C=Cc2cc(Cl)cc(Cl)c2O1 |
| InChI | InChI=1S/C17H16Cl2F3NO8/c1-10(30-15(24)28-6-4-27-5-7-29-23(25)26)16(17(20,21)22)3-2-11-8-12(18)9-13(19)14(11)31-16/h2-3,8-10H,4-7H2,1H3/t10?,16-/m0/s1 |
| InChIKey | CFRSSXOSOJHTAS-CSPPYYTDSA-N |
| XLogP | 4.47 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|