C16H15F8NO7S — CID 122700002
[(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)chromen-2-yl]methyl 1-nitrooxypropan-2-yl carbonate (PubChem CID 122700002) has the molecular formula C16H15F8NO7S and a molecular weight of 517.35 g/mol. Its IUPAC name is [(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)chromen-2-yl]methyl 1-nitrooxypropan-2-yl carbonate.
| Compound Name | [(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)chromen-2-yl]methyl 1-nitrooxypropan-2-yl carbonate |
|---|---|
| PubChem CID | 122700002 |
| Molecular Formula | C16H15F8NO7S |
| Molecular Weight | 517.35 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | [(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)chromen-2-yl]methyl 1-nitrooxypropan-2-yl carbonate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1O[C@@](COC(=O)OC(C)CO[N+](=O)[O-])(C(F)(F)F)C=C2 |
| InChI | InChI=1S/C16H15F8NO7S/c1-9-5-12(33(20,21,22,23)24)6-11-3-4-15(16(17,18)19,32-13(9)11)8-29-14(26)31-10(2)7-30-25(27)28/h3-6,10H,7-8H2,1-2H3/t10?,15-/m0/s1 |
| InChIKey | DTENYYYLJYUHQB-WRXSAAJRSA-N |
| XLogP | 6.11 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.35 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|