C22H24ClF3N2O9 — CID 122699895
[2-[acetyl(2-nitrooxyethyl)amino]acetyl]oxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699895) has the molecular formula C22H24ClF3N2O9 and a molecular weight of 552.89 g/mol. Its IUPAC name is [2-[acetyl(2-nitrooxyethyl)amino]acetyl]oxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | [2-[acetyl(2-nitrooxyethyl)amino]acetyl]oxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699895 |
| Molecular Formula | C22H24ClF3N2O9 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | [2-[acetyl(2-nitrooxyethyl)amino]acetyl]oxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(=O)N(CCO[N+](=O)[O-])CC(=O)OCOC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C22H24ClF3N2O9/c1-12(29)27(5-6-36-28(32)33)10-18(30)34-11-35-20(31)14-7-13-8-16(23)15(21(2,3)4)9-17(13)37-19(14)22(24,25)26/h7-9,19H,5-6,10-11H2,1-4H3 |
| InChIKey | RXXUKWVWQKVRTI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|