C18H18F6N2O7 — CID 122699641
2-[2-[[8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]ethoxy]ethyl nitrate (PubChem CID 122699641) has the molecular formula C18H18F6N2O7 and a molecular weight of 488.34 g/mol. Its IUPAC name is 2-[2-[[8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]ethoxy]ethyl nitrate.
| Compound Name | 2-[2-[[8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]ethoxy]ethyl nitrate |
|---|---|
| PubChem CID | 122699641 |
| Molecular Formula | C18H18F6N2O7 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-[2-[[8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]ethoxy]ethyl nitrate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)NCCOCCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C18H18F6N2O7/c1-2-10-7-12(33-18(22,23)24)8-11-9-13(15(17(19,20)21)32-14(10)11)16(27)25-3-4-30-5-6-31-26(28)29/h7-9,15H,2-6H2,1H3,(H,25,27) |
| InChIKey | HQRSNIVEZHDAJW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|