C18H12F4O4 — CID 151740428
2-(fluoromethyl)-6-[4-(trifluoromethyl)phenoxy]-2H-chromene-3-carboxylic acid (PubChem CID 151740428) has the molecular formula C18H12F4O4 and a molecular weight of 368.28 g/mol. Its IUPAC name is 2-(fluoromethyl)-6-[4-(trifluoromethyl)phenoxy]-2H-chromene-3-carboxylic acid.
| Compound Name | 2-(fluoromethyl)-6-[4-(trifluoromethyl)phenoxy]-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 151740428 |
| Molecular Formula | C18H12F4O4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(fluoromethyl)-6-[4-(trifluoromethyl)phenoxy]-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Oc3ccc(C(F)(F)F)cc3)ccc2OC1CF |
| InChI | InChI=1S/C18H12F4O4/c19-9-16-14(17(23)24)8-10-7-13(5-6-15(10)26-16)25-12-3-1-11(2-4-12)18(20,21)22/h1-8,16H,9H2,(H,23,24) |
| InChIKey | RMKIJJVHUBYCTP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |